C17H22N4O3 — CID 95211410
(5S)-5-ethyl-5-[1-(3-methylpyridine-2-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 95211410) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (5S)-5-ethyl-5-[1-(3-methylpyridine-2-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-ethyl-5-[1-(3-methylpyridine-2-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95211410 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (5S)-5-ethyl-5-[1-(3-methylpyridine-2-carbonyl)piperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C2CCN(C(=O)c3ncccc3C)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H22N4O3/c1-3-17(15(23)19-16(24)20-17)12-6-9-21(10-7-12)14(22)13-11(2)5-4-8-18-13/h4-5,8,12H,3,6-7,9-10H2,1-2H3,(H2,19,20,23,24)/t17-/m0/s1 |
| InChIKey | YXPVDUDRQZVKMQ-KRWDZBQOSA-N |
| XLogP | 1.23 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|