C18H22N6O — CID 95212656
N-[[(3R)-1-[(3-methyl-1H-indol-2-yl)methyl]pyrrolidin-3-yl]methyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 95212656) has the molecular formula C18H22N6O and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[[(3R)-1-[(3-methyl-1H-indol-2-yl)methyl]pyrrolidin-3-yl]methyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[[(3R)-1-[(3-methyl-1H-indol-2-yl)methyl]pyrrolidin-3-yl]methyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 95212656 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | N-[[(3R)-1-[(3-methyl-1H-indol-2-yl)methyl]pyrrolidin-3-yl]methyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Cc1c(CN2CC[C@H](CNC(=O)c3ncn[nH]3)C2)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H22N6O/c1-12-14-4-2-3-5-15(14)22-16(12)10-24-7-6-13(9-24)8-19-18(25)17-20-11-21-23-17/h2-5,11,13,22H,6-10H2,1H3,(H,19,25)(H,20,21,23)/t13-/m1/s1 |
| InChIKey | YZALDFDBHAULQX-CYBMUJFWSA-N |
| XLogP | 1.85 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|