C18H23N3O3 — CID 95212814
N-ethyl-N-[[(2S)-oxolan-2-yl]methyl]-5-(phenoxymethyl)-1H-pyrazole-3-carboxamide (PubChem CID 95212814) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-ethyl-N-[[(2S)-oxolan-2-yl]methyl]-5-(phenoxymethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-ethyl-N-[[(2S)-oxolan-2-yl]methyl]-5-(phenoxymethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95212814 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-ethyl-N-[[(2S)-oxolan-2-yl]methyl]-5-(phenoxymethyl)-1H-pyrazole-3-carboxamide |
| SMILES | CCN(C[C@@H]1CCCO1)C(=O)c1cc(COc2ccccc2)[nH]n1 |
| InChI | InChI=1S/C18H23N3O3/c1-2-21(12-16-9-6-10-23-16)18(22)17-11-14(19-20-17)13-24-15-7-4-3-5-8-15/h3-5,7-8,11,16H,2,6,9-10,12-13H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | DPONHKZMYMFFIN-INIZCTEOSA-N |
| XLogP | 2.63 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |