C14H17N3O4S3 — CID 95213025
2-[methyl-[(1S)-1-(1,3-thiazol-5-yl)ethyl]sulfamoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 95213025) has the molecular formula C14H17N3O4S3 and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-[methyl-[(1S)-1-(1,3-thiazol-5-yl)ethyl]sulfamoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 2-[methyl-[(1S)-1-(1,3-thiazol-5-yl)ethyl]sulfamoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 95213025 |
| Molecular Formula | C14H17N3O4S3 |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 2-[methyl-[(1S)-1-(1,3-thiazol-5-yl)ethyl]sulfamoyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | C[C@@H](c1cncs1)N(C)S(=O)(=O)c1sc2c(c1C(=O)O)CCNC2 |
| InChI | InChI=1S/C14H17N3O4S3/c1-8(10-5-16-7-22-10)17(2)24(20,21)14-12(13(18)19)9-3-4-15-6-11(9)23-14/h5,7-8,15H,3-4,6H2,1-2H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | DHCVOTAZQWFAKL-QMMMGPOBSA-N |
| XLogP | 1.93 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |