C21H24N4O3 — CID 95213369
(5S)-5-[1-[(2-hydroxy-5-methylphenyl)methyl]piperidin-4-yl]-5-pyridin-3-ylimidazolidine-2,4-dione (PubChem CID 95213369) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is (5S)-5-[1-[(2-hydroxy-5-methylphenyl)methyl]piperidin-4-yl]-5-pyridin-3-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[1-[(2-hydroxy-5-methylphenyl)methyl]piperidin-4-yl]-5-pyridin-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95213369 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (5S)-5-[1-[(2-hydroxy-5-methylphenyl)methyl]piperidin-4-yl]-5-pyridin-3-ylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(O)c(CN2CCC([C@@]3(c4cccnc4)NC(=O)NC3=O)CC2)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-14-4-5-18(26)15(11-14)13-25-9-6-16(7-10-25)21(17-3-2-8-22-12-17)19(27)23-20(28)24-21/h2-5,8,11-12,16,26H,6-7,9-10,13H2,1H3,(H2,23,24,27,28)/t21-/m0/s1 |
| InChIKey | WGMWSOVKRMSJBN-NRFANRHFSA-N |
| XLogP | 2.04 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|