C16H25N3O2 — CID 95214259
1-[(3R)-3-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]-4-methylpentane-1,2-dione (PubChem CID 95214259) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[(3R)-3-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]-4-methylpentane-1,2-dione.
| Compound Name | 1-[(3R)-3-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]-4-methylpentane-1,2-dione |
|---|---|
| PubChem CID | 95214259 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-[(3R)-3-(4-ethyl-1H-pyrazol-5-yl)piperidin-1-yl]-4-methylpentane-1,2-dione |
| SMILES | CCc1cn[nH]c1[C@@H]1CCCN(C(=O)C(=O)CC(C)C)C1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-12-9-17-18-15(12)13-6-5-7-19(10-13)16(21)14(20)8-11(2)3/h9,11,13H,4-8,10H2,1-3H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | KKCZYEFMCMTSQY-CYBMUJFWSA-N |
| XLogP | 2.29 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|