C12H21N3O3 — CID 95214954
(4S)-4,6-dimethyl-2-oxo-N-(2-propoxyethyl)-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 95214954) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (4S)-4,6-dimethyl-2-oxo-N-(2-propoxyethyl)-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4S)-4,6-dimethyl-2-oxo-N-(2-propoxyethyl)-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 95214954 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (4S)-4,6-dimethyl-2-oxo-N-(2-propoxyethyl)-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CCCOCCNC(=O)C1=C(C)NC(=O)N[C@H]1C |
| InChI | InChI=1S/C12H21N3O3/c1-4-6-18-7-5-13-11(16)10-8(2)14-12(17)15-9(10)3/h8H,4-7H2,1-3H3,(H,13,16)(H2,14,15,17)/t8-/m0/s1 |
| InChIKey | FEHIZNDPRITSHA-QMMMGPOBSA-N |
| XLogP | 0.50 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|