C23H26N2O2 — CID 95215735
2-[[4-[(1S)-1-hydroxy-2-phenylethyl]piperidin-1-yl]methyl]quinolin-8-ol (PubChem CID 95215735) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[[4-[(1S)-1-hydroxy-2-phenylethyl]piperidin-1-yl]methyl]quinolin-8-ol.
| Compound Name | 2-[[4-[(1S)-1-hydroxy-2-phenylethyl]piperidin-1-yl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 95215735 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-[[4-[(1S)-1-hydroxy-2-phenylethyl]piperidin-1-yl]methyl]quinolin-8-ol |
| SMILES | Oc1cccc2ccc(CN3CCC([C@@H](O)Cc4ccccc4)CC3)nc12 |
| InChI | InChI=1S/C23H26N2O2/c26-21-8-4-7-19-9-10-20(24-23(19)21)16-25-13-11-18(12-14-25)22(27)15-17-5-2-1-3-6-17/h1-10,18,22,26-27H,11-16H2/t22-/m0/s1 |
| InChIKey | ZQDOBNJWENKSMF-QFIPXVFZSA-N |
| XLogP | 3.76 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |