C18H18N6OS — CID 95216096
3-methyl-5-[[(4S)-4-[1-(1,3-thiazol-2-yl)pyrrol-2-yl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-1,2-oxazole (PubChem CID 95216096) has the molecular formula C18H18N6OS and a molecular weight of 366.45 g/mol. Its IUPAC name is 3-methyl-5-[[(4S)-4-[1-(1,3-thiazol-2-yl)pyrrol-2-yl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-1,2-oxazole.
| Compound Name | 3-methyl-5-[[(4S)-4-[1-(1,3-thiazol-2-yl)pyrrol-2-yl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 95216096 |
| Molecular Formula | C18H18N6OS |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3-methyl-5-[[(4S)-4-[1-(1,3-thiazol-2-yl)pyrrol-2-yl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]methyl]-1,2-oxazole |
| SMILES | Cc1cc(CN2CCc3[nH]cnc3[C@@H]2c2cccn2-c2nccs2)on1 |
| InChI | InChI=1S/C18H18N6OS/c1-12-9-13(25-22-12)10-23-7-4-14-16(21-11-20-14)17(23)15-3-2-6-24(15)18-19-5-8-26-18/h2-3,5-6,8-9,11,17H,4,7,10H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | PRQJSBYRCLXDSU-KRWDZBQOSA-N |
| XLogP | 3.10 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |