About 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole
5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole (PubChem CID 95219253) has the molecular formula C15H19N3O4S
and a molecular weight of 337.40 g/mol. Its IUPAC name is 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole |
| PubChem CID | 95219253 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole |
| SMILES | O=S(=O)(c1ccc(-c2ccno2)o1)N1CCC[C@]2(CCNC2)C1 |
| InChI | InChI=1S/C15H19N3O4S/c19-23(20,14-3-2-12(21-14)13-4-7-17-22-13)18-9-1-5-15(11-18)6-8-16-10-15/h2-4,7,16H,1,5-6,8-11H2/t15-/m1/s1 |
| InChIKey | SPVJBOAOOLNYNO-OAHLLOKOSA-N |
| XLogP | 1.70 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole?
The IUPAC name of 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole (CID 95219253) is 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole.
What is the SMILES notation for 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole?
The canonical SMILES for 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole is O=S(=O)(c1ccc(-c2ccno2)o1)N1CCC[C@]2(CCNC2)C1.
What is the InChIKey of 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole?
The InChIKey is SPVJBOAOOLNYNO-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H19N3O4S/c19-23(20,14-3-2-12(21-14)13-4-7-17-22-13)18-9-1-5-15(11-18)6-8-16-10-15/h2-4,7,16H,1,5-6,8-11H2/t15-/m1/s1.
What are the key properties of 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole?
5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole has a molecular weight of 337.40 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[[(5R)-2,7-diazaspiro[4.5]decan-7-yl]sulfonyl]furan-2-yl]-1,2-oxazole is sourced from PubChem (CID 95219253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).