C17H22N2O4 — CID 95219403
(2R)-4-[(8-methoxy-2H-chromen-3-yl)methyl]-1-methylpiperazine-2-carboxylic acid (PubChem CID 95219403) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2R)-4-[(8-methoxy-2H-chromen-3-yl)methyl]-1-methylpiperazine-2-carboxylic acid.
| Compound Name | (2R)-4-[(8-methoxy-2H-chromen-3-yl)methyl]-1-methylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 95219403 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (2R)-4-[(8-methoxy-2H-chromen-3-yl)methyl]-1-methylpiperazine-2-carboxylic acid |
| SMILES | COc1cccc2c1OCC(CN1CCN(C)[C@@H](C(=O)O)C1)=C2 |
| InChI | InChI=1S/C17H22N2O4/c1-18-6-7-19(10-14(18)17(20)21)9-12-8-13-4-3-5-15(22-2)16(13)23-11-12/h3-5,8,14H,6-7,9-11H2,1-2H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | AKUPRORZYNITRK-CQSZACIVSA-N |
| XLogP | 1.17 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |