About 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide
2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide (PubChem CID 95219513) has the molecular formula C20H21N5O
and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide |
| PubChem CID | 95219513 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide |
| SMILES | Cc1ccc(C)c([C@@H](NC(=O)c2cc(C)nc(N)n2)c2cccnc2)c1 |
| InChI | InChI=1S/C20H21N5O/c1-12-6-7-13(2)16(9-12)18(15-5-4-8-22-11-15)25-19(26)17-10-14(3)23-20(21)24-17/h4-11,18H,1-3H3,(H,25,26)(H2,21,23,24)/t18-/m0/s1 |
| InChIKey | MFMDERHREHACTB-SFHVURJKSA-N |
| XLogP | 2.90 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide?
The IUPAC name of 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide (CID 95219513) is 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide.
What is the SMILES notation for 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide?
The canonical SMILES for 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide is Cc1ccc(C)c([C@@H](NC(=O)c2cc(C)nc(N)n2)c2cccnc2)c1.
What is the InChIKey of 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide?
The InChIKey is MFMDERHREHACTB-SFHVURJKSA-N. The full InChI is InChI=1S/C20H21N5O/c1-12-6-7-13(2)16(9-12)18(15-5-4-8-22-11-15)25-19(26)17-10-14(3)23-20(21)24-17/h4-11,18H,1-3H3,(H,25,26)(H2,21,23,24)/t18-/m0/s1.
What are the key properties of 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide?
2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide has a molecular weight of 347.42 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(R)-(2,5-dimethylphenyl)-pyridin-3-ylmethyl]-6-methylpyrimidine-4-carboxamide is sourced from PubChem (CID 95219513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).