C18H23N5O3 — CID 95220111
(9aR)-2-[1-(2-hydroxyethyl)benzimidazole-5-carbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one (PubChem CID 95220111) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (9aR)-2-[1-(2-hydroxyethyl)benzimidazole-5-carbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one.
| Compound Name | (9aR)-2-[1-(2-hydroxyethyl)benzimidazole-5-carbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 95220111 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (9aR)-2-[1-(2-hydroxyethyl)benzimidazole-5-carbonyl]-8-methyl-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-9-one |
| SMILES | CN1CCN2CCN(C(=O)c3ccc4c(c3)ncn4CCO)C[C@@H]2C1=O |
| InChI | InChI=1S/C18H23N5O3/c1-20-4-5-21-6-7-22(11-16(21)18(20)26)17(25)13-2-3-15-14(10-13)19-12-23(15)8-9-24/h2-3,10,12,16,24H,4-9,11H2,1H3/t16-/m1/s1 |
| InChIKey | AFEQZBJYCPNCIR-MRXNPFEDSA-N |
| XLogP | -0.37 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |