C17H24N4O — CID 95220305
(2R)-7-methoxy-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 95220305) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is (2R)-7-methoxy-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2R)-7-methoxy-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 95220305 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | (2R)-7-methoxy-N-[(4-propyl-1,2,4-triazol-3-yl)methyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCn1cnnc1CN[C@@H]1CCc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C17H24N4O/c1-3-8-21-12-19-20-17(21)11-18-15-6-4-13-5-7-16(22-2)10-14(13)9-15/h5,7,10,12,15,18H,3-4,6,8-9,11H2,1-2H3/t15-/m1/s1 |
| InChIKey | ZPVCPDLZYUCPAB-OAHLLOKOSA-N |
| XLogP | 2.34 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |