C18H21N3O3 — CID 95221192
1-[4-[(2S)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 95221192) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[4-[(2S)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[4-[(2S)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95221192 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[4-[(2S)-2-butyl-2,5-dihydropyrrole-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | CCCC[C@H]1C=CCN1C(=O)c1ccc(N2CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-2-3-5-14-6-4-11-20(14)17(23)13-7-9-15(10-8-13)21-12-16(22)19-18(21)24/h4,6-10,14H,2-3,5,11-12H2,1H3,(H,19,22,24)/t14-/m0/s1 |
| InChIKey | HRKLXFYRTAYCNV-AWEZNQCLSA-N |
| XLogP | 2.31 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|