About 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one
1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 95221814) has the molecular formula C16H20F3N3O2
and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 95221814 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)N1CC[C@@]2(CCCNC2)C1 |
| InChI | InChI=1S/C16H20F3N3O2/c17-16(18,19)12-2-3-13(23)22(8-12)9-14(24)21-7-5-15(11-21)4-1-6-20-10-15/h2-3,8,20H,1,4-7,9-11H2/t15-/m1/s1 |
| InChIKey | BBTXWMRRKFKMSO-OAHLLOKOSA-N |
| XLogP | 1.47 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one (CID 95221814) is 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one is O=C(Cn1cc(C(F)(F)F)ccc1=O)N1CC[C@@]2(CCCNC2)C1.
What is the InChIKey of 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is BBTXWMRRKFKMSO-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H20F3N3O2/c17-16(18,19)12-2-3-13(23)22(8-12)9-14(24)21-7-5-15(11-21)4-1-6-20-10-15/h2-3,8,20H,1,4-7,9-11H2/t15-/m1/s1.
What are the key properties of 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one?
1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 343.35 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 95221814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).