C18H28N2O4 — CID 95222280
(3R)-1-[(2,3-dimethoxyphenyl)methyl]-3-hydroxy-3-(propylaminomethyl)piperidin-2-one (PubChem CID 95222280) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is (3R)-1-[(2,3-dimethoxyphenyl)methyl]-3-hydroxy-3-(propylaminomethyl)piperidin-2-one.
| Compound Name | (3R)-1-[(2,3-dimethoxyphenyl)methyl]-3-hydroxy-3-(propylaminomethyl)piperidin-2-one |
|---|---|
| PubChem CID | 95222280 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (3R)-1-[(2,3-dimethoxyphenyl)methyl]-3-hydroxy-3-(propylaminomethyl)piperidin-2-one |
| SMILES | CCCNC[C@]1(O)CCCN(Cc2cccc(OC)c2OC)C1=O |
| InChI | InChI=1S/C18H28N2O4/c1-4-10-19-13-18(22)9-6-11-20(17(18)21)12-14-7-5-8-15(23-2)16(14)24-3/h5,7-8,19,22H,4,6,9-13H2,1-3H3/t18-/m1/s1 |
| InChIKey | QSJUCAJTNOFQTC-GOSISDBHSA-N |
| XLogP | 1.56 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|