C19H35N3O — CID 95222569
2,2,3-trimethyl-N-[[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]methyl]but-3-enamide (PubChem CID 95222569) has the molecular formula C19H35N3O and a molecular weight of 321.51 g/mol. Its IUPAC name is 2,2,3-trimethyl-N-[[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]methyl]but-3-enamide.
| Compound Name | 2,2,3-trimethyl-N-[[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]methyl]but-3-enamide |
|---|---|
| PubChem CID | 95222569 |
| Molecular Formula | C19H35N3O |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.28 |
| IUPAC Name | 2,2,3-trimethyl-N-[[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]methyl]but-3-enamide |
| SMILES | C=C(C)C(C)(C)C(=O)NC[C@H]1CCCN(C2CCN(C)CC2)C1 |
| InChI | InChI=1S/C19H35N3O/c1-15(2)19(3,4)18(23)20-13-16-7-6-10-22(14-16)17-8-11-21(5)12-9-17/h16-17H,1,6-14H2,2-5H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | FIIPDOGKTKJKSD-MRXNPFEDSA-N |
| XLogP | 2.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|