C17H30N2O3 — CID 95223725
1-[(2R)-2-[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]-2-methoxyethanone (PubChem CID 95223725) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[(2R)-2-[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[(2R)-2-[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 95223725 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-[(2R)-2-[1-(2-ethoxyethyl)-3,6-dihydro-2H-pyridin-5-yl]piperidin-1-yl]-2-methoxyethanone |
| SMILES | CCOCCN1CCC=C([C@H]2CCCCN2C(=O)COC)C1 |
| InChI | InChI=1S/C17H30N2O3/c1-3-22-12-11-18-9-6-7-15(13-18)16-8-4-5-10-19(16)17(20)14-21-2/h7,16H,3-6,8-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | MHKWQJKGGPZMPV-MRXNPFEDSA-N |
| XLogP | 1.68 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|