C12H20F3N3 — CID 95225503
(2S)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-4,4,4-trifluorobutan-2-amine (PubChem CID 95225503) has the molecular formula C12H20F3N3 and a molecular weight of 263.31 g/mol. Its IUPAC name is (2S)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-4,4,4-trifluorobutan-2-amine.
| Compound Name | (2S)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-4,4,4-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 95225503 |
| Molecular Formula | C12H20F3N3 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (2S)-N-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propyl]-4,4,4-trifluorobutan-2-amine |
| SMILES | Cc1n[nH]c(C)c1CCCN[C@@H](C)CC(F)(F)F |
| InChI | InChI=1S/C12H20F3N3/c1-8(7-12(13,14)15)16-6-4-5-11-9(2)17-18-10(11)3/h8,16H,4-7H2,1-3H3,(H,17,18)/t8-/m0/s1 |
| InChIKey | SPXFEYXQYQPIGN-QMMMGPOBSA-N |
| XLogP | 2.89 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|