C19H24N2O3 — CID 95226562
N-[2-[(3R)-1-(furan-2-ylmethyl)piperidin-3-yl]ethyl]-3-hydroxybenzamide (PubChem CID 95226562) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[2-[(3R)-1-(furan-2-ylmethyl)piperidin-3-yl]ethyl]-3-hydroxybenzamide.
| Compound Name | N-[2-[(3R)-1-(furan-2-ylmethyl)piperidin-3-yl]ethyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 95226562 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[2-[(3R)-1-(furan-2-ylmethyl)piperidin-3-yl]ethyl]-3-hydroxybenzamide |
| SMILES | O=C(NCC[C@H]1CCCN(Cc2ccco2)C1)c1cccc(O)c1 |
| InChI | InChI=1S/C19H24N2O3/c22-17-6-1-5-16(12-17)19(23)20-9-8-15-4-2-10-21(13-15)14-18-7-3-11-24-18/h1,3,5-7,11-12,15,22H,2,4,8-10,13-14H2,(H,20,23)/t15-/m1/s1 |
| InChIKey | GUNCJZSDYUBCRN-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |