C18H19N5O — CID 95227310
N-[(1R)-1-(2,5-dimethylphenyl)ethyl]-2-(2H-tetrazol-5-yl)benzamide (PubChem CID 95227310) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethylphenyl)ethyl]-2-(2H-tetrazol-5-yl)benzamide.
| Compound Name | N-[(1R)-1-(2,5-dimethylphenyl)ethyl]-2-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 95227310 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethylphenyl)ethyl]-2-(2H-tetrazol-5-yl)benzamide |
| SMILES | Cc1ccc(C)c([C@@H](C)NC(=O)c2ccccc2-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C18H19N5O/c1-11-8-9-12(2)16(10-11)13(3)19-18(24)15-7-5-4-6-14(15)17-20-22-23-21-17/h4-10,13H,1-3H3,(H,19,24)(H,20,21,22,23)/t13-/m1/s1 |
| InChIKey | IGVBLNRKDYJDSS-CYBMUJFWSA-N |
| XLogP | 2.97 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |