C17H25N3O2 — CID 95230398
(4S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 95230398) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (4S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | (4S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 95230398 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (4S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-4,6-dimethyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | C=CCC1(CC=C)CCCN1C(=O)C1=C(C)NC(=O)N[C@H]1C |
| InChI | InChI=1S/C17H25N3O2/c1-5-8-17(9-6-2)10-7-11-20(17)15(21)14-12(3)18-16(22)19-13(14)4/h5-6,12H,1-2,7-11H2,3-4H3,(H2,18,19,22)/t12-/m0/s1 |
| InChIKey | JCSZEZZHNIZPAG-LBPRGKRZSA-N |
| XLogP | 2.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|