About methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate
methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate (PubChem CID 95230691) has the molecular formula C19H26N4O3
and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate |
| PubChem CID | 95230691 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate |
| SMILES | CC[C@@H](C(=O)OC)n1nc(C2CCNCC2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H26N4O3/c1-3-16(18(24)26-2)23-19(25)22(13-14-7-5-4-6-8-14)17(21-23)15-9-11-20-12-10-15/h4-8,15-16,20H,3,9-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | UONZMLCGGPMBBW-INIZCTEOSA-N |
| XLogP | 1.68 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate?
The IUPAC name of methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate (CID 95230691) is methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate.
What is the SMILES notation for methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate?
The canonical SMILES for methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate is CC[C@@H](C(=O)OC)n1nc(C2CCNCC2)n(Cc2ccccc2)c1=O.
What is the InChIKey of methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate?
The InChIKey is UONZMLCGGPMBBW-INIZCTEOSA-N. The full InChI is InChI=1S/C19H26N4O3/c1-3-16(18(24)26-2)23-19(25)22(13-14-7-5-4-6-8-14)17(21-23)15-9-11-20-12-10-15/h4-8,15-16,20H,3,9-13H2,1-2H3/t16-/m0/s1.
What are the key properties of methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate?
methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate has a molecular weight of 358.44 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(4-benzyl-5-oxo-3-piperidin-4-yl-1,2,4-triazol-1-yl)butanoate is sourced from PubChem (CID 95230691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).