C16H16N4O2 — CID 95233258
N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-1-methyl-6-oxopyridine-3-carboxamide (PubChem CID 95233258) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-1-methyl-6-oxopyridine-3-carboxamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-1-methyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 95233258 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-1-methyl-6-oxopyridine-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc(=O)n(C)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H16N4O2/c1-10(15-18-12-5-3-4-6-13(12)19-15)17-16(22)11-7-8-14(21)20(2)9-11/h3-10H,1-2H3,(H,17,22)(H,18,19)/t10-/m1/s1 |
| InChIKey | RTXGCJQGUPHNGL-SNVBAGLBSA-N |
| XLogP | 1.75 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |