C21H16Br2 — CID 95240162
(14S,15S)-14,15-dibromo-3-methyltetracyclo[14.4.0.02,7.08,13]icosa-1(20),2,4,6,8,10,12,16,18-nonaene (PubChem CID 95240162) has the molecular formula C21H16Br2 and a molecular weight of 428.17 g/mol. Its IUPAC name is (14S,15S)-14,15-dibromo-3-methyltetracyclo[14.4.0.02,7.08,13]icosa-1(20),2,4,6,8,10,12,16,18-nonaene.
| Compound Name | (14S,15S)-14,15-dibromo-3-methyltetracyclo[14.4.0.02,7.08,13]icosa-1(20),2,4,6,8,10,12,16,18-nonaene |
|---|---|
| PubChem CID | 95240162 |
| Molecular Formula | C21H16Br2 |
| Molecular Weight | 428.17 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | (14S,15S)-14,15-dibromo-3-methyltetracyclo[14.4.0.02,7.08,13]icosa-1(20),2,4,6,8,10,12,16,18-nonaene |
| SMILES | Cc1cccc2c1-c1ccccc1[C@H](Br)[C@@H](Br)c1ccccc1-2 |
| InChI | InChI=1S/C21H16Br2/c1-13-7-6-12-15-14-8-2-4-10-17(14)20(22)21(23)18-11-5-3-9-16(18)19(13)15/h2-12,20-21H,1H3/t20-,21-/m0/s1 |
| InChIKey | SOUDCZZCCSUUMO-SFTDATJTSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.17 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|