About (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran
(2S)-2-(difluoromethyl)-2,5,5-trifluorofuran (PubChem CID 95241679) has the molecular formula C5H3F5O
and a molecular weight of 174.07 g/mol. Its IUPAC name is (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran.
Molecular Properties
| Compound Name | (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran |
| PubChem CID | 95241679 |
| Molecular Formula | C5H3F5O |
| Molecular Weight | 174.07 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran |
| SMILES | FC(F)[C@@]1(F)C=CC(F)(F)O1 |
| InChI | InChI=1S/C5H3F5O/c6-3(7)4(8)1-2-5(9,10)11-4/h1-3H/t4-/m1/s1 |
| InChIKey | BSAHOECCAIKUGF-SCSAIBSYSA-N |
| XLogP | 2.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.07 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran?
The IUPAC name of (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran (CID 95241679) is (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran.
What is the SMILES notation for (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran?
The canonical SMILES for (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran is FC(F)[C@@]1(F)C=CC(F)(F)O1.
What is the InChIKey of (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran?
The InChIKey is BSAHOECCAIKUGF-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H3F5O/c6-3(7)4(8)1-2-5(9,10)11-4/h1-3H/t4-/m1/s1.
What are the key properties of (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran?
(2S)-2-(difluoromethyl)-2,5,5-trifluorofuran has a molecular weight of 174.07 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(difluoromethyl)-2,5,5-trifluorofuran is sourced from PubChem (CID 95241679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).