C17H31N — CID 95241869
(2S)-N-tert-butyl-2-[(1R,2R,4S)-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl]butan-1-imine (PubChem CID 95241869) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is (2S)-N-tert-butyl-2-[(1R,2R,4S)-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl]butan-1-imine.
| Compound Name | (2S)-N-tert-butyl-2-[(1R,2R,4S)-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl]butan-1-imine |
|---|---|
| PubChem CID | 95241869 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (2S)-N-tert-butyl-2-[(1R,2R,4S)-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl]butan-1-imine |
| SMILES | CC[C@H](/C=N/C(C)(C)C)[C@H]1[C@@H]2CC[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C17H31N/c1-7-12(11-18-16(2,3)4)15-13-8-9-14(10-13)17(15,5)6/h11-15H,7-10H2,1-6H3/b18-11+/t12-,13-,14+,15+/m1/s1 |
| InChIKey | MRWDZJBLVASXQP-ZATLJNTKSA-N |
| XLogP | 4.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|