C16H20N6O2 — CID 95242999
[(2S)-oxolan-2-yl]-[4-(6-pyrazol-1-ylpyrazin-2-yl)piperazin-1-yl]methanone (PubChem CID 95242999) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]-[4-(6-pyrazol-1-ylpyrazin-2-yl)piperazin-1-yl]methanone.
| Compound Name | [(2S)-oxolan-2-yl]-[4-(6-pyrazol-1-ylpyrazin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95242999 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(2S)-oxolan-2-yl]-[4-(6-pyrazol-1-ylpyrazin-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C([C@@H]1CCCO1)N1CCN(c2cncc(-n3cccn3)n2)CC1 |
| InChI | InChI=1S/C16H20N6O2/c23-16(13-3-1-10-24-13)21-8-6-20(7-9-21)14-11-17-12-15(19-14)22-5-2-4-18-22/h2,4-5,11-13H,1,3,6-10H2/t13-/m0/s1 |
| InChIKey | PVPRCWZMEGQYTA-ZDUSSCGKSA-N |
| XLogP | 0.49 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |