About 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide
3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide (PubChem CID 95246047) has the molecular formula C18H17F3N2O
and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide.
Molecular Properties
| Compound Name | 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide |
| PubChem CID | 95246047 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide |
| SMILES | O=C(CCc1ccccn1)N[C@@H]1C[C@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O/c19-18(20,21)13-5-3-4-12(10-13)15-11-16(15)23-17(24)8-7-14-6-1-2-9-22-14/h1-6,9-10,15-16H,7-8,11H2,(H,23,24)/t15-,16+/m0/s1 |
| InChIKey | LKZIFRMMZHBCGB-JKSUJKDBSA-N |
| XLogP | 3.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide?
The IUPAC name of 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide (CID 95246047) is 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide.
What is the SMILES notation for 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide?
The canonical SMILES for 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide is O=C(CCc1ccccn1)N[C@@H]1C[C@H]1c1cccc(C(F)(F)F)c1.
What is the InChIKey of 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide?
The InChIKey is LKZIFRMMZHBCGB-JKSUJKDBSA-N. The full InChI is InChI=1S/C18H17F3N2O/c19-18(20,21)13-5-3-4-12(10-13)15-11-16(15)23-17(24)8-7-14-6-1-2-9-22-14/h1-6,9-10,15-16H,7-8,11H2,(H,23,24)/t15-,16+/m0/s1.
What are the key properties of 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide?
3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide has a molecular weight of 334.34 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-yl-N-[(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropyl]propanamide is sourced from PubChem (CID 95246047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).