C14H20Cl2N2O — CID 95246520
(3S)-N-(3,5-dichloro-2-pyridinyl)-3,5,5-trimethylhexanamide (PubChem CID 95246520) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is (3S)-N-(3,5-dichloro-2-pyridinyl)-3,5,5-trimethylhexanamide.
| Compound Name | (3S)-N-(3,5-dichloro-2-pyridinyl)-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 95246520 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (3S)-N-(3,5-dichloro-2-pyridinyl)-3,5,5-trimethylhexanamide |
| SMILES | C[C@H](CC(=O)Nc1ncc(Cl)cc1Cl)CC(C)(C)C |
| InChI | InChI=1S/C14H20Cl2N2O/c1-9(7-14(2,3)4)5-12(19)18-13-11(16)6-10(15)8-17-13/h6,8-9H,5,7H2,1-4H3,(H,17,18,19)/t9-/m1/s1 |
| InChIKey | CMKUAUWVZJEJDU-SECBINFHSA-N |
| XLogP | 4.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |