C20H19ClF3N3O2 — CID 95247853
(3S)-1-(4-chlorobenzoyl)-N'-[3-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide (PubChem CID 95247853) has the molecular formula C20H19ClF3N3O2 and a molecular weight of 425.84 g/mol. Its IUPAC name is (3S)-1-(4-chlorobenzoyl)-N'-[3-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide.
| Compound Name | (3S)-1-(4-chlorobenzoyl)-N'-[3-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 95247853 |
| Molecular Formula | C20H19ClF3N3O2 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (3S)-1-(4-chlorobenzoyl)-N'-[3-(trifluoromethyl)phenyl]piperidine-3-carbohydrazide |
| SMILES | O=C(NNc1cccc(C(F)(F)F)c1)[C@H]1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H19ClF3N3O2/c21-16-8-6-13(7-9-16)19(29)27-10-2-3-14(12-27)18(28)26-25-17-5-1-4-15(11-17)20(22,23)24/h1,4-9,11,14,25H,2-3,10,12H2,(H,26,28)/t14-/m0/s1 |
| InChIKey | ISWVBZXCMGYYOW-AWEZNQCLSA-N |
| XLogP | 4.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|