C25H34N4O4S — CID 95248817
1-[[(2R)-1-benzylpiperidin-2-yl]methyl]-3-[(4-morpholin-4-ylsulfonylphenyl)methyl]urea (PubChem CID 95248817) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is 1-[[(2R)-1-benzylpiperidin-2-yl]methyl]-3-[(4-morpholin-4-ylsulfonylphenyl)methyl]urea.
| Compound Name | 1-[[(2R)-1-benzylpiperidin-2-yl]methyl]-3-[(4-morpholin-4-ylsulfonylphenyl)methyl]urea |
|---|---|
| PubChem CID | 95248817 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 1-[[(2R)-1-benzylpiperidin-2-yl]methyl]-3-[(4-morpholin-4-ylsulfonylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NC[C@H]1CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C25H34N4O4S/c30-25(27-19-23-8-4-5-13-28(23)20-22-6-2-1-3-7-22)26-18-21-9-11-24(12-10-21)34(31,32)29-14-16-33-17-15-29/h1-3,6-7,9-12,23H,4-5,8,13-20H2,(H2,26,27,30)/t23-/m1/s1 |
| InChIKey | MKJDUPOXHMLGRV-HSZRJFAPSA-N |
| XLogP | 2.56 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |