C11H12ClN3OS — CID 95257494
2-(2-chloroanilino)-N-(4,5-dihydro-1,3-thiazol-2-yl)acetamide (PubChem CID 95257494) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 2-(2-chloroanilino)-N-(4,5-dihydro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2-chloroanilino)-N-(4,5-dihydro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 95257494 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-(2-chloroanilino)-N-(4,5-dihydro-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CNc1ccccc1Cl)NC1=NCCS1 |
| InChI | InChI=1S/C11H12ClN3OS/c12-8-3-1-2-4-9(8)14-7-10(16)15-11-13-5-6-17-11/h1-4,14H,5-7H2,(H,13,15,16) |
| InChIKey | NPDIYYKFNMZGLQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |