C17H22N4OS — CID 95261587
1-[(2R)-1-imidazol-1-ylpropan-2-yl]-3-[(1-phenylsulfanylcyclopropyl)methyl]urea (PubChem CID 95261587) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-[(2R)-1-imidazol-1-ylpropan-2-yl]-3-[(1-phenylsulfanylcyclopropyl)methyl]urea.
| Compound Name | 1-[(2R)-1-imidazol-1-ylpropan-2-yl]-3-[(1-phenylsulfanylcyclopropyl)methyl]urea |
|---|---|
| PubChem CID | 95261587 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[(2R)-1-imidazol-1-ylpropan-2-yl]-3-[(1-phenylsulfanylcyclopropyl)methyl]urea |
| SMILES | C[C@H](Cn1ccnc1)NC(=O)NCC1(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C17H22N4OS/c1-14(11-21-10-9-18-13-21)20-16(22)19-12-17(7-8-17)23-15-5-3-2-4-6-15/h2-6,9-10,13-14H,7-8,11-12H2,1H3,(H2,19,20,22)/t14-/m1/s1 |
| InChIKey | VJRNOZPKDUAGMA-CQSZACIVSA-N |
| XLogP | 2.90 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |