About cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide
cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide (PubChem CID 95265346) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide |
| PubChem CID | 95265346 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide |
| SMILES | C=CCN(C(=O)[C@H]1C[C@H]1c1cnn(C)c1)C1CCCC1 |
| InChI | InChI=1S/C16H23N3O/c1-3-8-19(13-6-4-5-7-13)16(20)15-9-14(15)12-10-17-18(2)11-12/h3,10-11,13-15H,1,4-9H2,2H3/t14-,15-/m0/s1 |
| InChIKey | BHZZPNLMYTYRNK-GJZGRUSLSA-N |
| XLogP | 2.48 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide?
The IUPAC name of cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide (CID 95265346) is cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide.
What is the SMILES notation for cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide?
The canonical SMILES for cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide is C=CCN(C(=O)[C@H]1C[C@H]1c1cnn(C)c1)C1CCCC1.
What is the InChIKey of cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide?
The InChIKey is BHZZPNLMYTYRNK-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H23N3O/c1-3-8-19(13-6-4-5-7-13)16(20)15-9-14(15)12-10-17-18(2)11-12/h3,10-11,13-15H,1,4-9H2,2H3/t14-,15-/m0/s1.
What are the key properties of cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide?
cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide has a molecular weight of 273.38 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-N-cyclopentyl-2-(1-methylpyrazol-4-yl)-N-prop-2-enylcyclopropane-1-carboxamide is sourced from PubChem (CID 95265346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).