C15H19NO6S — CID 95270031
(2S)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-2-prop-2-enoxypropanamide (PubChem CID 95270031) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is (2S)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-2-prop-2-enoxypropanamide.
| Compound Name | (2S)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-2-prop-2-enoxypropanamide |
|---|---|
| PubChem CID | 95270031 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (2S)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)-2-prop-2-enoxypropanamide |
| SMILES | C=CCO[C@@H](C)C(=O)NS(=O)(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C15H19NO6S/c1-3-7-20-11(2)15(17)16-23(18,19)12-5-6-13-14(10-12)22-9-4-8-21-13/h3,5-6,10-11H,1,4,7-9H2,2H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | BIZFMRFMCAGOLC-NSHDSACASA-N |
| XLogP | 1.24 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|