C18H33N5 — CID 95274939
(1R,8aR)-N-[[5-(dimethylamino)-1-methyl-3-propan-2-ylpyrazol-4-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 95274939) has the molecular formula C18H33N5 and a molecular weight of 319.50 g/mol. Its IUPAC name is (1R,8aR)-N-[[5-(dimethylamino)-1-methyl-3-propan-2-ylpyrazol-4-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | (1R,8aR)-N-[[5-(dimethylamino)-1-methyl-3-propan-2-ylpyrazol-4-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 95274939 |
| Molecular Formula | C18H33N5 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.27 |
| IUPAC Name | (1R,8aR)-N-[[5-(dimethylamino)-1-methyl-3-propan-2-ylpyrazol-4-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | CC(C)c1nn(C)c(N(C)C)c1CN[C@@H]1CCN2CCCC[C@H]12 |
| InChI | InChI=1S/C18H33N5/c1-13(2)17-14(18(21(3)4)22(5)20-17)12-19-15-9-11-23-10-7-6-8-16(15)23/h13,15-16,19H,6-12H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | YKEAEIRXDQAFSU-HZPDHXFCSA-N |
| XLogP | 2.33 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |