C14H14Cl3N3O2 — CID 95275027
(2R)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-(2,4,6-trichlorophenyl)propanehydrazide (PubChem CID 95275027) has the molecular formula C14H14Cl3N3O2 and a molecular weight of 362.64 g/mol. Its IUPAC name is (2R)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-(2,4,6-trichlorophenyl)propanehydrazide.
| Compound Name | (2R)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-(2,4,6-trichlorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 95275027 |
| Molecular Formula | C14H14Cl3N3O2 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (2R)-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-(2,4,6-trichlorophenyl)propanehydrazide |
| SMILES | Cc1noc(C)c1[C@@H](C)C(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl3N3O2/c1-6(12-7(2)20-22-8(12)3)14(21)19-18-13-10(16)4-9(15)5-11(13)17/h4-6,18H,1-3H3,(H,19,21)/t6-/m1/s1 |
| InChIKey | OWTXPDOBQDIGPM-ZCFIWIBFSA-N |
| XLogP | 4.50 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|