C13H25N3O5S — CID 95275410
methyl 4-[[2-[(3S)-3-(methanesulfonamido)piperidin-1-yl]acetyl]amino]butanoate (PubChem CID 95275410) has the molecular formula C13H25N3O5S and a molecular weight of 335.43 g/mol. Its IUPAC name is methyl 4-[[2-[(3S)-3-(methanesulfonamido)piperidin-1-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[(3S)-3-(methanesulfonamido)piperidin-1-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 95275410 |
| Molecular Formula | C13H25N3O5S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | methyl 4-[[2-[(3S)-3-(methanesulfonamido)piperidin-1-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1CCC[C@H](NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H25N3O5S/c1-21-13(18)6-3-7-14-12(17)10-16-8-4-5-11(9-16)15-22(2,19)20/h11,15H,3-10H2,1-2H3,(H,14,17)/t11-/m0/s1 |
| InChIKey | IMEZUKSZKCYFPK-NSHDSACASA-N |
| XLogP | -0.93 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|