C16H20ClNO3 — CID 95275872
(2S)-2-but-3-enoxy-N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]propanamide (PubChem CID 95275872) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is (2S)-2-but-3-enoxy-N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]propanamide.
| Compound Name | (2S)-2-but-3-enoxy-N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]propanamide |
|---|---|
| PubChem CID | 95275872 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2S)-2-but-3-enoxy-N-[(4S)-8-chloro-3,4-dihydro-2H-chromen-4-yl]propanamide |
| SMILES | C=CCCO[C@@H](C)C(=O)N[C@H]1CCOc2c(Cl)cccc21 |
| InChI | InChI=1S/C16H20ClNO3/c1-3-4-9-20-11(2)16(19)18-14-8-10-21-15-12(14)6-5-7-13(15)17/h3,5-7,11,14H,1,4,8-10H2,2H3,(H,18,19)/t11-,14-/m0/s1 |
| InChIKey | BDDPVQNNRBXTDY-FZMZJTMJSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|