C15H22N6O — CID 95277051
(2R)-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-1-pyrazol-1-ylpropan-2-amine (PubChem CID 95277051) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is (2R)-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-1-pyrazol-1-ylpropan-2-amine.
| Compound Name | (2R)-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-1-pyrazol-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 95277051 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2R)-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-1-pyrazol-1-ylpropan-2-amine |
| SMILES | C[C@H](Cn1cccn1)NCc1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C15H22N6O/c1-13(12-21-4-2-3-19-21)16-9-14-10-17-15(18-11-14)20-5-7-22-8-6-20/h2-4,10-11,13,16H,5-9,12H2,1H3/t13-/m1/s1 |
| InChIKey | LCPGHQLVVCNMKK-CYBMUJFWSA-N |
| XLogP | 0.69 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |