C13H18N4 — CID 95277106
(2S,3S)-3-pyrazol-1-yl-N-(pyridin-4-ylmethyl)butan-2-amine (PubChem CID 95277106) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is (2S,3S)-3-pyrazol-1-yl-N-(pyridin-4-ylmethyl)butan-2-amine.
| Compound Name | (2S,3S)-3-pyrazol-1-yl-N-(pyridin-4-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 95277106 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2S,3S)-3-pyrazol-1-yl-N-(pyridin-4-ylmethyl)butan-2-amine |
| SMILES | C[C@H](NCc1ccncc1)[C@H](C)n1cccn1 |
| InChI | InChI=1S/C13H18N4/c1-11(12(2)17-9-3-6-16-17)15-10-13-4-7-14-8-5-13/h3-9,11-12,15H,10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | CSIALOJBZURQKV-RYUDHWBXSA-N |
| XLogP | 2.02 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |