C30H25N5S2 — CID 95277368
(3R)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-N-phenyl-5-thiophen-3-yl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 95277368) has the molecular formula C30H25N5S2 and a molecular weight of 519.70 g/mol. Its IUPAC name is (3R)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-N-phenyl-5-thiophen-3-yl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | (3R)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-N-phenyl-5-thiophen-3-yl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 95277368 |
| Molecular Formula | C30H25N5S2 |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (3R)-3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-N-phenyl-5-thiophen-3-yl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2[C@H]2CC(c3ccsc3)=NN2C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C30H25N5S2/c1-21-12-14-22(15-13-21)29-26(19-34(33-29)25-10-6-3-7-11-25)28-18-27(23-16-17-37-20-23)32-35(28)30(36)31-24-8-4-2-5-9-24/h2-17,19-20,28H,18H2,1H3,(H,31,36)/t28-/m1/s1 |
| InChIKey | XFYKIIKNUHPBBG-MUUNZHRXSA-N |
| XLogP | 7.46 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|