C12H17N5O — CID 95277512
4-methoxy-N-[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]pyrimidin-2-amine (PubChem CID 95277512) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 4-methoxy-N-[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]pyrimidin-2-amine.
| Compound Name | 4-methoxy-N-[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 95277512 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-methoxy-N-[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]pyrimidin-2-amine |
| SMILES | COc1ccnc(N[C@H](C)[C@H](C)n2cccn2)n1 |
| InChI | InChI=1S/C12H17N5O/c1-9(10(2)17-8-4-6-14-17)15-12-13-7-5-11(16-12)18-3/h4-10H,1-3H3,(H,13,15,16)/t9-,10+/m1/s1 |
| InChIKey | VMJGZSNLXPQEHI-ZJUUUORDSA-N |
| XLogP | 1.74 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |