C18H23FN4O2 — CID 95277610
N-[2-(4-fluorophenyl)ethyl]-2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]acetamide (PubChem CID 95277610) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]acetamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 95277610 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-[(2R)-2-(pyrazol-1-ylmethyl)morpholin-4-yl]acetamide |
| SMILES | O=C(CN1CCO[C@@H](Cn2cccn2)C1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN4O2/c19-16-4-2-15(3-5-16)6-8-20-18(24)14-22-10-11-25-17(12-22)13-23-9-1-7-21-23/h1-5,7,9,17H,6,8,10-14H2,(H,20,24)/t17-/m1/s1 |
| InChIKey | LNQXKCXFDLBZMU-QGZVFWFLSA-N |
| XLogP | 1.08 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |