C19H16FN3O — CID 95279011
(E)-3-(4-fluorophenyl)-N-[(4-imidazol-1-ylphenyl)methyl]prop-2-enamide (PubChem CID 95279011) has the molecular formula C19H16FN3O and a molecular weight of 321.36 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[(4-imidazol-1-ylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[(4-imidazol-1-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 95279011 |
| Molecular Formula | C19H16FN3O |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[(4-imidazol-1-ylphenyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C19H16FN3O/c20-17-6-1-15(2-7-17)5-10-19(24)22-13-16-3-8-18(9-4-16)23-12-11-21-14-23/h1-12,14H,13H2,(H,22,24)/b10-5+ |
| InChIKey | FNFUIKPEUZYIOX-BJMVGYQFSA-N |
| XLogP | 3.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|