About (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine
(2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine (PubChem CID 95279219) has the molecular formula C15H23N5O2
and a molecular weight of 305.38 g/mol. Its IUPAC name is (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine.
Molecular Properties
| Compound Name | (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine |
| PubChem CID | 95279219 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine |
| SMILES | CCCCc1nc(CN2CCO[C@H](Cn3cccn3)C2)no1 |
| InChI | InChI=1S/C15H23N5O2/c1-2-3-5-15-17-14(18-22-15)12-19-8-9-21-13(10-19)11-20-7-4-6-16-20/h4,6-7,13H,2-3,5,8-12H2,1H3/t13-/m0/s1 |
| InChIKey | PNYSLKJCZJROKF-ZDUSSCGKSA-N |
| XLogP | 1.51 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine?
The IUPAC name of (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine (CID 95279219) is (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine.
What is the SMILES notation for (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine?
The canonical SMILES for (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine is CCCCc1nc(CN2CCO[C@H](Cn3cccn3)C2)no1.
What is the InChIKey of (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine?
The InChIKey is PNYSLKJCZJROKF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H23N5O2/c1-2-3-5-15-17-14(18-22-15)12-19-8-9-21-13(10-19)11-20-7-4-6-16-20/h4,6-7,13H,2-3,5,8-12H2,1H3/t13-/m0/s1.
What are the key properties of (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine?
(2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine has a molecular weight of 305.38 g/mol, XLogP of 1.51, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-(pyrazol-1-ylmethyl)morpholine is sourced from PubChem (CID 95279219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).