C17H24N4O3 — CID 95282305
1-[1-(2-hydroxyethyl)-3-(2-methylphenyl)pyrazol-5-yl]-3-[(2R)-1-methoxypropan-2-yl]urea (PubChem CID 95282305) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethyl)-3-(2-methylphenyl)pyrazol-5-yl]-3-[(2R)-1-methoxypropan-2-yl]urea.
| Compound Name | 1-[1-(2-hydroxyethyl)-3-(2-methylphenyl)pyrazol-5-yl]-3-[(2R)-1-methoxypropan-2-yl]urea |
|---|---|
| PubChem CID | 95282305 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[1-(2-hydroxyethyl)-3-(2-methylphenyl)pyrazol-5-yl]-3-[(2R)-1-methoxypropan-2-yl]urea |
| SMILES | COC[C@@H](C)NC(=O)Nc1cc(-c2ccccc2C)nn1CCO |
| InChI | InChI=1S/C17H24N4O3/c1-12-6-4-5-7-14(12)15-10-16(21(20-15)8-9-22)19-17(23)18-13(2)11-24-3/h4-7,10,13,22H,8-9,11H2,1-3H3,(H2,18,19,23)/t13-/m1/s1 |
| InChIKey | VKZKXTLFYHRSKO-CYBMUJFWSA-N |
| XLogP | 2.01 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |