C17H25NO4 — CID 95282629
(2R)-2-(2-ethoxyethoxy)-N-[(5S)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]propanamide (PubChem CID 95282629) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2R)-2-(2-ethoxyethoxy)-N-[(5S)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]propanamide.
| Compound Name | (2R)-2-(2-ethoxyethoxy)-N-[(5S)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]propanamide |
|---|---|
| PubChem CID | 95282629 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (2R)-2-(2-ethoxyethoxy)-N-[(5S)-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]propanamide |
| SMILES | CCOCCO[C@H](C)C(=O)N[C@H]1CCCOc2ccccc21 |
| InChI | InChI=1S/C17H25NO4/c1-3-20-11-12-21-13(2)17(19)18-15-8-6-10-22-16-9-5-4-7-14(15)16/h4-5,7,9,13,15H,3,6,8,10-12H2,1-2H3,(H,18,19)/t13-,15+/m1/s1 |
| InChIKey | SUDBYTLPGXCXCU-HIFRSBDPSA-N |
| XLogP | 2.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|